C6H8O5 — CID 24771766
(3R,4S,5R)-3,4,5-trihydroxycyclohexane-1,2-dione (PubChem CID 24771766) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5-trihydroxycyclohexane-1,2-dione.
| Compound Name | (3R,4S,5R)-3,4,5-trihydroxycyclohexane-1,2-dione |
|---|---|
| PubChem CID | 24771766 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (3R,4S,5R)-3,4,5-trihydroxycyclohexane-1,2-dione |
| SMILES | O=C1C[C@@H](O)[C@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C6H8O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2,4,6-7,9,11H,1H2/t2-,4+,6-/m1/s1 |
| InChIKey | SHFQRUVRUBHHRE-CJPQEGFPSA-N |
| XLogP | -2.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|