C5H4N4O3 — CID 24771781
5,7-dihydro-3H-purine-2,6,8-trione (PubChem CID 24771781) has the molecular formula C5H4N4O3 and a molecular weight of 168.11 g/mol. Its IUPAC name is 5,7-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 5,7-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 24771781 |
| Molecular Formula | C5H4N4O3 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 5,7-dihydro-3H-purine-2,6,8-trione |
| SMILES | O=C1N=C2NC(=O)NC(=O)C2N1 |
| InChI | InChI=1S/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1H,(H3,6,7,8,9,10,11,12) |
| InChIKey | KLMXEVHMXUCFEP-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |