About 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one
5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one (PubChem CID 24772321) has the molecular formula C17H20FN3O
and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one.
Molecular Properties
| Compound Name | 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one |
| PubChem CID | 24772321 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one |
| SMILES | CC(C)(C)C1C(=O)N(Cc2ccc(F)cc2)Cc2cncn21 |
| InChI | InChI=1S/C17H20FN3O/c1-17(2,3)15-16(22)20(10-14-8-19-11-21(14)15)9-12-4-6-13(18)7-5-12/h4-8,11,15H,9-10H2,1-3H3 |
| InChIKey | DGNARKBNDIDZPP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one?
The IUPAC name of 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one (CID 24772321) is 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one.
What is the SMILES notation for 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one?
The canonical SMILES for 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one is CC(C)(C)C1C(=O)N(Cc2ccc(F)cc2)Cc2cncn21.
What is the InChIKey of 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one?
The InChIKey is DGNARKBNDIDZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O/c1-17(2,3)15-16(22)20(10-14-8-19-11-21(14)15)9-12-4-6-13(18)7-5-12/h4-8,11,15H,9-10H2,1-3H3.
What are the key properties of 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one?
5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one has a molecular weight of 301.37 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-7-[(4-fluorophenyl)methyl]-5,8-dihydroimidazo[1,5-a]pyrazin-6-one is sourced from PubChem (CID 24772321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).