About [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 2477265) has the molecular formula C20H24N2O5
and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate |
| PubChem CID | 2477265 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)c2ccncc2)cc1OCC |
| InChI | InChI=1S/C20H24N2O5/c1-3-25-17-6-5-15(13-18(17)26-4-2)7-12-22-19(23)14-27-20(24)16-8-10-21-11-9-16/h5-6,8-11,13H,3-4,7,12,14H2,1-2H3,(H,22,23) |
| InChIKey | VUPLIYXRCTXCQB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate?
The IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate (CID 2477265) is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate.
What is the SMILES notation for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate?
The canonical SMILES for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate is CCOc1ccc(CCNC(=O)COC(=O)c2ccncc2)cc1OCC.
What is the InChIKey of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate?
The InChIKey is VUPLIYXRCTXCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O5/c1-3-25-17-6-5-15(13-18(17)26-4-2)7-12-22-19(23)14-27-20(24)16-8-10-21-11-9-16/h5-6,8-11,13H,3-4,7,12,14H2,1-2H3,(H,22,23).
What are the key properties of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate?
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate has a molecular weight of 372.42 g/mol, XLogP of 2.39, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyridine-4-carboxylate is sourced from PubChem (CID 2477265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).