C13H16N2O3 — CID 24773175
methyl (3R,5R)-2-benzoyl-5-methylpyrazolidine-3-carboxylate (PubChem CID 24773175) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (3R,5R)-2-benzoyl-5-methylpyrazolidine-3-carboxylate.
| Compound Name | methyl (3R,5R)-2-benzoyl-5-methylpyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 24773175 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl (3R,5R)-2-benzoyl-5-methylpyrazolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C)NN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-8-11(13(17)18-2)15(14-9)12(16)10-6-4-3-5-7-10/h3-7,9,11,14H,8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | HXJGOYPTZNIUHX-MWLCHTKSSA-N |
| XLogP | 0.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |