C16H31IO2Si — CID 24773229
(E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-6-enal (PubChem CID 24773229) has the molecular formula C16H31IO2Si and a molecular weight of 410.41 g/mol. Its IUPAC name is (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-6-enal.
| Compound Name | (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-6-enal |
|---|---|
| PubChem CID | 24773229 |
| Molecular Formula | C16H31IO2Si |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-6-enal |
| SMILES | C/C(=C\I)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C16H31IO2Si/c1-12(10-17)9-13(2)15(14(3)11-18)19-20(7,8)16(4,5)6/h10-11,13-15H,9H2,1-8H3/b12-10+/t13-,14+,15-/m0/s1 |
| InChIKey | WDXHEBYQSMMSPE-RSWYFJNCSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|