C23H25N3O7 — CID 24773364
4-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]butanoic acid (PubChem CID 24773364) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]butanoic acid.
| Compound Name | 4-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 24773364 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]butanoic acid |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(CCCC(=O)O)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C23H25N3O7/c1-32-22(30)17-19(14-8-3-5-11-24-14)26(13-7-10-16(27)28)20(15-9-4-6-12-25-15)18(21(17)29)23(31)33-2/h3-6,8-9,11-12,17-20H,7,10,13H2,1-2H3,(H,27,28)/t17?,18?,19-,20+ |
| InChIKey | XLFJRJNUSLQVFR-KHSMEXAKSA-N |
| XLogP | 1.59 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|