C26H28O3 — CID 24773453
1-[5-tert-butyl-2,4-bis(phenylmethoxy)phenyl]ethanone (PubChem CID 24773453) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[5-tert-butyl-2,4-bis(phenylmethoxy)phenyl]ethanone.
| Compound Name | 1-[5-tert-butyl-2,4-bis(phenylmethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 24773453 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[5-tert-butyl-2,4-bis(phenylmethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(C(C)(C)C)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O3/c1-19(27)22-15-23(26(2,3)4)25(29-18-21-13-9-6-10-14-21)16-24(22)28-17-20-11-7-5-8-12-20/h5-16H,17-18H2,1-4H3 |
| InChIKey | IJYAWQDRWLYGOA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |