C15H14N2O6 — CID 24773714
2,3-dihydroxy-N'-(2-hydroxy-3-methoxybenzoyl)benzohydrazide (PubChem CID 24773714) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2,3-dihydroxy-N'-(2-hydroxy-3-methoxybenzoyl)benzohydrazide.
| Compound Name | 2,3-dihydroxy-N'-(2-hydroxy-3-methoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 24773714 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2,3-dihydroxy-N'-(2-hydroxy-3-methoxybenzoyl)benzohydrazide |
| SMILES | COc1cccc(C(=O)NNC(=O)c2cccc(O)c2O)c1O |
| InChI | InChI=1S/C15H14N2O6/c1-23-11-7-3-5-9(13(11)20)15(22)17-16-14(21)8-4-2-6-10(18)12(8)19/h2-7,18-20H,1H3,(H,16,21)(H,17,22) |
| InChIKey | FWIVOWZHCISZFX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|