C12H16ClN — CID 24773728
(5S)-7-chloro-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 24773728) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (5S)-7-chloro-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | (5S)-7-chloro-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 24773728 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (5S)-7-chloro-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | CC[C@@H]1CNCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClN/c1-2-9-8-14-6-5-10-3-4-11(13)7-12(9)10/h3-4,7,9,14H,2,5-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | DNLSOPHLIKCIIV-SECBINFHSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |