C16H19IN2OS — CID 24773805
[3-amino-4-[2-[(dimethylamino)methyl]-4-iodophenyl]sulfanylphenyl]methanol (PubChem CID 24773805) has the molecular formula C16H19IN2OS and a molecular weight of 414.31 g/mol. Its IUPAC name is [3-amino-4-[2-[(dimethylamino)methyl]-4-iodophenyl]sulfanylphenyl]methanol.
| Compound Name | [3-amino-4-[2-[(dimethylamino)methyl]-4-iodophenyl]sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 24773805 |
| Molecular Formula | C16H19IN2OS |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | [3-amino-4-[2-[(dimethylamino)methyl]-4-iodophenyl]sulfanylphenyl]methanol |
| SMILES | CN(C)Cc1cc(I)ccc1Sc1ccc(CO)cc1N |
| InChI | InChI=1S/C16H19IN2OS/c1-19(2)9-12-8-13(17)4-6-15(12)21-16-5-3-11(10-20)7-14(16)18/h3-8,20H,9-10,18H2,1-2H3 |
| InChIKey | ZUJSUIUCXPKMMG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|