C16H10N2O7 — CID 24773887
2-(4,5-dihydroxy-3-oxo-1H-isoindol-2-yl)-5,6-dihydroxyisoindole-1,3-dione (PubChem CID 24773887) has the molecular formula C16H10N2O7 and a molecular weight of 342.26 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-3-oxo-1H-isoindol-2-yl)-5,6-dihydroxyisoindole-1,3-dione.
| Compound Name | 2-(4,5-dihydroxy-3-oxo-1H-isoindol-2-yl)-5,6-dihydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 24773887 |
| Molecular Formula | C16H10N2O7 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-(4,5-dihydroxy-3-oxo-1H-isoindol-2-yl)-5,6-dihydroxyisoindole-1,3-dione |
| SMILES | O=C1c2c(ccc(O)c2O)CN1N1C(=O)c2cc(O)c(O)cc2C1=O |
| InChI | InChI=1S/C16H10N2O7/c19-9-2-1-6-5-17(16(25)12(6)13(9)22)18-14(23)7-3-10(20)11(21)4-8(7)15(18)24/h1-4,19-22H,5H2 |
| InChIKey | UHNBPWWIHMRHBY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|