C12H17NO — CID 24773900
7-methoxy-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 24773900) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 7-methoxy-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-methoxy-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 24773900 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 7-methoxy-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | COc1ccc2c(c1)C(C)CNCC2 |
| InChI | InChI=1S/C12H17NO/c1-9-8-13-6-5-10-3-4-11(14-2)7-12(9)10/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | VCCXGIDBLWAVNF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |