C60H78N6 — CID 24774382
1-butyl-4-[2,3,4,5,6-pentakis(1-butyl-4-pyridinylidene)cyclohexylidene]pyridine (PubChem CID 24774382) has the molecular formula C60H78N6 and a molecular weight of 883.33 g/mol. Its IUPAC name is 1-butyl-4-[2,3,4,5,6-pentakis(1-butyl-4-pyridinylidene)cyclohexylidene]pyridine.
| Compound Name | 1-butyl-4-[2,3,4,5,6-pentakis(1-butyl-4-pyridinylidene)cyclohexylidene]pyridine |
|---|---|
| PubChem CID | 24774382 |
| Molecular Formula | C60H78N6 |
| Molecular Weight | 883.33 g/mol |
| Exact Mass | 882.63 |
| IUPAC Name | 1-butyl-4-[2,3,4,5,6-pentakis(1-butyl-4-pyridinylidene)cyclohexylidene]pyridine |
| SMILES | CCCCN1C=CC(=c2c(=C3C=CN(CCCC)C=C3)c(=C3C=CN(CCCC)C=C3)c(=C3C=CN(CCCC)C=C3)c(=C3C=CN(CCCC)C=C3)c2=C2C=CN(CCCC)C=C2)C=C1 |
| InChI | InChI=1S/C60H78N6/c1-7-13-31-61-37-19-49(20-38-61)55-56(50-21-39-62(40-22-50)32-14-8-2)58(52-25-43-64(44-26-52)34-16-10-4)60(54-29-47-66(48-30-54)36-18-12-6)59(53-27-45-65(46-28-53)35-17-11-5)57(55)51-23-41-63(42-24-51)33-15-9-3/h19-30,37-48H,7-18,31-36H2,1-6H3 |
| InChIKey | UPOLIUTXTCSLLL-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.33 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |