C21H23N3O3 — CID 24774427
ethyl (8R,8aS)-8-cyano-5-methyl-6-oxo-7,8a,9,10,11,12-hexahydroquinolino[3,4-c]quinolizine-8-carboxylate (PubChem CID 24774427) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl (8R,8aS)-8-cyano-5-methyl-6-oxo-7,8a,9,10,11,12-hexahydroquinolino[3,4-c]quinolizine-8-carboxylate.
| Compound Name | ethyl (8R,8aS)-8-cyano-5-methyl-6-oxo-7,8a,9,10,11,12-hexahydroquinolino[3,4-c]quinolizine-8-carboxylate |
|---|---|
| PubChem CID | 24774427 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | ethyl (8R,8aS)-8-cyano-5-methyl-6-oxo-7,8a,9,10,11,12-hexahydroquinolino[3,4-c]quinolizine-8-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)Cc2c(c3ccccc3n(C)c2=O)N2CCCC[C@H]21 |
| InChI | InChI=1S/C21H23N3O3/c1-3-27-20(26)21(13-22)12-15-18(24-11-7-6-10-17(21)24)14-8-4-5-9-16(14)23(2)19(15)25/h4-5,8-9,17H,3,6-7,10-12H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | NDFNTCKMVHCJMN-UWJYYQICSA-N |
| XLogP | 2.53 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |