C27H33N3O7 — CID 24774444
8-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]octanoic acid (PubChem CID 24774444) has the molecular formula C27H33N3O7 and a molecular weight of 511.58 g/mol. Its IUPAC name is 8-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]octanoic acid.
| Compound Name | 8-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]octanoic acid |
|---|---|
| PubChem CID | 24774444 |
| Molecular Formula | C27H33N3O7 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 8-[(2S,6R)-3,5-bis(methoxycarbonyl)-4-oxo-2,6-dipyridin-2-ylpiperidin-1-yl]octanoic acid |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(CCCCCCCC(=O)O)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C27H33N3O7/c1-36-26(34)21-23(18-12-7-9-15-28-18)30(17-11-5-3-4-6-14-20(31)32)24(19-13-8-10-16-29-19)22(25(21)33)27(35)37-2/h7-10,12-13,15-16,21-24H,3-6,11,14,17H2,1-2H3,(H,31,32)/t21?,22?,23-,24+ |
| InChIKey | CGCCJOQRVQUCFH-ULBZPVTCSA-N |
| XLogP | 3.15 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|