C26H25N3O5 — CID 24774445
dimethyl (2S,6R)-1-benzyl-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate (PubChem CID 24774445) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is dimethyl (2S,6R)-1-benzyl-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S,6R)-1-benzyl-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24774445 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | dimethyl (2S,6R)-1-benzyl-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(Cc2ccccc2)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C26H25N3O5/c1-33-25(31)20-22(18-12-6-8-14-27-18)29(16-17-10-4-3-5-11-17)23(19-13-7-9-15-28-19)21(24(20)30)26(32)34-2/h3-15,20-23H,16H2,1-2H3/t20?,21?,22-,23+ |
| InChIKey | QPNUFISNMPNHKP-MYNGYRLFSA-N |
| XLogP | 2.92 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|