C24H25NO5 — CID 24774528
dimethyl (2S,6R)-4-oxo-2,6-diphenyl-1-prop-2-enylpiperidine-3,5-dicarboxylate (PubChem CID 24774528) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is dimethyl (2S,6R)-4-oxo-2,6-diphenyl-1-prop-2-enylpiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S,6R)-4-oxo-2,6-diphenyl-1-prop-2-enylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24774528 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | dimethyl (2S,6R)-4-oxo-2,6-diphenyl-1-prop-2-enylpiperidine-3,5-dicarboxylate |
| SMILES | C=CCN1[C@H](c2ccccc2)C(C(=O)OC)C(=O)C(C(=O)OC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO5/c1-4-15-25-20(16-11-7-5-8-12-16)18(23(27)29-2)22(26)19(24(28)30-3)21(25)17-13-9-6-10-14-17/h4-14,18-21H,1,15H2,2-3H3/t18?,19?,20-,21+ |
| InChIKey | IWOMETVPPHVWKN-ZAYGCWILSA-N |
| XLogP | 3.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|