C29H26F5N2O3+ — CID 24774706
[(3R)-1-[2-(4-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 24774706) has the molecular formula C29H26F5N2O3+ and a molecular weight of 545.53 g/mol. Its IUPAC name is [(3R)-1-[2-(4-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | [(3R)-1-[2-(4-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 24774706 |
| Molecular Formula | C29H26F5N2O3+ |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [(3R)-1-[2-(4-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)N(Cc1cc(F)c(F)c(F)c1)c1cccc(F)c1)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H26F5N2O3/c30-21-6-4-19(5-7-21)26(37)16-36-10-8-20(9-11-36)27(17-36)39-29(38)35(23-3-1-2-22(31)14-23)15-18-12-24(32)28(34)25(33)13-18/h1-7,12-14,20,27H,8-11,15-17H2/q+1/t20?,27-,36?/m0/s1 |
| InChIKey | DQLBTICHGIMXLP-GCLLAJJUSA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|