C27H23ClF7NO2 — CID 24774838
3-[5-(4-chloro-3-methylphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 24774838) has the molecular formula C27H23ClF7NO2 and a molecular weight of 561.93 g/mol. Its IUPAC name is 3-[5-(4-chloro-3-methylphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[5-(4-chloro-3-methylphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24774838 |
| Molecular Formula | C27H23ClF7NO2 |
| Molecular Weight | 561.93 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 3-[5-(4-chloro-3-methylphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc(-c2cccc3c2CCC(c2cccc(OC(F)(F)C(F)F)c2)N3CC(O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C27H23ClF7NO2/c1-15-12-16(8-10-21(15)28)19-6-3-7-23-20(19)9-11-22(36(23)14-24(37)26(31,32)33)17-4-2-5-18(13-17)38-27(34,35)25(29)30/h2-8,10,12-13,22,24-25,37H,9,11,14H2,1H3 |
| InChIKey | WDQOPJIGSHXFBL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.93 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|