C27H21F7N2O2 — CID 24774924
3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-(3,3,3-trifluoro-2-hydroxypropyl)-3,4-dihydro-2H-quinolin-5-yl]benzonitrile (PubChem CID 24774924) has the molecular formula C27H21F7N2O2 and a molecular weight of 538.46 g/mol. Its IUPAC name is 3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-(3,3,3-trifluoro-2-hydroxypropyl)-3,4-dihydro-2H-quinolin-5-yl]benzonitrile.
| Compound Name | 3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-(3,3,3-trifluoro-2-hydroxypropyl)-3,4-dihydro-2H-quinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 24774924 |
| Molecular Formula | C27H21F7N2O2 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-(3,3,3-trifluoro-2-hydroxypropyl)-3,4-dihydro-2H-quinolin-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc3c2CCC(c2cccc(OC(F)(F)C(F)F)c2)N3CC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F7N2O2/c28-25(29)27(33,34)38-19-7-2-6-18(13-19)22-11-10-21-20(17-5-1-4-16(12-17)14-35)8-3-9-23(21)36(22)15-24(37)26(30,31)32/h1-9,12-13,22,24-25,37H,10-11,15H2 |
| InChIKey | ZHCGXQXIFZHXAG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|