About [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate (PubChem CID 2477493) has the molecular formula C15H13ClN2O3
and a molecular weight of 304.73 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate |
| PubChem CID | 2477493 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate |
| SMILES | O=C(COC(=O)Cc1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H13ClN2O3/c16-12-6-7-13(17-9-12)18-14(19)10-21-15(20)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,17,18,19) |
| InChIKey | NBVRGKVQBPHIJB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate?
The IUPAC name of [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate (CID 2477493) is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate.
What is the SMILES notation for [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate?
The canonical SMILES for [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate is O=C(COC(=O)Cc1ccccc1)Nc1ccc(Cl)cn1.
What is the InChIKey of [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate?
The InChIKey is NBVRGKVQBPHIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2O3/c16-12-6-7-13(17-9-12)18-14(19)10-21-15(20)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,17,18,19).
What are the key properties of [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate?
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate has a molecular weight of 304.73 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylacetate is sourced from PubChem (CID 2477493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).