C26H22ClF6NO3 — CID 24775284
1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-3-chloropropan-2-ol (PubChem CID 24775284) has the molecular formula C26H22ClF6NO3 and a molecular weight of 545.91 g/mol. Its IUPAC name is 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-3-chloropropan-2-ol.
| Compound Name | 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 24775284 |
| Molecular Formula | C26H22ClF6NO3 |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-3-chloropropan-2-ol |
| SMILES | OC(CCl)CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2CCC1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C26H22ClF6NO3/c27-14-18(35)15-34-23(17-5-2-7-20(13-17)37-26(31,32)33)11-10-22-21(8-3-9-24(22)34)16-4-1-6-19(12-16)36-25(28,29)30/h1-9,12-13,18,23,35H,10-11,14-15H2 |
| InChIKey | DLNHKQIOTRJLQP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|