C21H23N3O2 — CID 24775414
1,3-diethyl-6-phenyl-6-[(E)-2-phenylethenyl]-1,3,5-triazinane-2,4-dione (PubChem CID 24775414) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1,3-diethyl-6-phenyl-6-[(E)-2-phenylethenyl]-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3-diethyl-6-phenyl-6-[(E)-2-phenylethenyl]-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 24775414 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1,3-diethyl-6-phenyl-6-[(E)-2-phenylethenyl]-1,3,5-triazinane-2,4-dione |
| SMILES | CCN1C(=O)NC(/C=C/c2ccccc2)(c2ccccc2)N(CC)C1=O |
| InChI | InChI=1S/C21H23N3O2/c1-3-23-19(25)22-21(24(4-2)20(23)26,18-13-9-6-10-14-18)16-15-17-11-7-5-8-12-17/h5-16H,3-4H2,1-2H3,(H,22,25)/b16-15+ |
| InChIKey | LVSXQLACLVMFRD-FOCLMDBBSA-N |
| XLogP | 4.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |