C29H28F7NO3 — CID 24775566
1,1,1-trifluoro-3-[5-(3-propan-2-yloxyphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol (PubChem CID 24775566) has the molecular formula C29H28F7NO3 and a molecular weight of 571.53 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[5-(3-propan-2-yloxyphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[5-(3-propan-2-yloxyphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 24775566 |
| Molecular Formula | C29H28F7NO3 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 1,1,1-trifluoro-3-[5-(3-propan-2-yloxyphenyl)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
| SMILES | CC(C)Oc1cccc(-c2cccc3c2CCC(c2cccc(OC(F)(F)C(F)F)c2)N3CC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H28F7NO3/c1-17(2)39-20-8-3-6-18(14-20)22-10-5-11-25-23(22)12-13-24(37(25)16-26(38)28(32,33)34)19-7-4-9-21(15-19)40-29(35,36)27(30)31/h3-11,14-15,17,24,26-27,38H,12-13,16H2,1-2H3 |
| InChIKey | ULDQNRYNQKSXBT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|