About ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate
ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate (PubChem CID 24775714) has the molecular formula C22H18F2N2O3
and a molecular weight of 396.39 g/mol. Its IUPAC name is ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate.
Molecular Properties
| Compound Name | ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate |
| PubChem CID | 24775714 |
| Molecular Formula | C22H18F2N2O3 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(-c2ccc(NC(=O)c3c(F)cccc3F)nc2)c1 |
| InChI | InChI=1S/C22H18F2N2O3/c1-3-29-22(28)14-8-7-13(2)16(11-14)15-9-10-19(25-12-15)26-21(27)20-17(23)5-4-6-18(20)24/h4-12H,3H2,1-2H3,(H,25,26,27) |
| InChIKey | NRDRFIQYLSOEAF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate?
The IUPAC name of ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate (CID 24775714) is ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate.
What is the SMILES notation for ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate?
The canonical SMILES for ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate is CCOC(=O)c1ccc(C)c(-c2ccc(NC(=O)c3c(F)cccc3F)nc2)c1.
What is the InChIKey of ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate?
The InChIKey is NRDRFIQYLSOEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2O3/c1-3-29-22(28)14-8-7-13(2)16(11-14)15-9-10-19(25-12-15)26-21(27)20-17(23)5-4-6-18(20)24/h4-12H,3H2,1-2H3,(H,25,26,27).
What are the key properties of ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate?
ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate has a molecular weight of 396.39 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[6-[(2,6-difluorobenzoyl)amino]-3-pyridinyl]-4-methylbenzoate is sourced from PubChem (CID 24775714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).