About methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate
methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate (PubChem CID 24775720) has the molecular formula C17H18N4OS
and a molecular weight of 326.43 g/mol. Its IUPAC name is methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate.
Molecular Properties
| Compound Name | methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate |
| PubChem CID | 24775720 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate |
| SMILES | C/N=C(\SC)N1CCCC1c1cc(-c2cccc(C#N)c2)on1 |
| InChI | InChI=1S/C17H18N4OS/c1-19-17(23-2)21-8-4-7-15(21)14-10-16(22-20-14)13-6-3-5-12(9-13)11-18/h3,5-6,9-10,15H,4,7-8H2,1-2H3/b19-17- |
| InChIKey | APTSBMJQUQPBHQ-ZPHPHTNESA-N |
| XLogP | 3.70 |
| TPSA | 65.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The IUPAC name of methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate (CID 24775720) is methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate.
What is the SMILES notation for methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The canonical SMILES for methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate is C/N=C(\SC)N1CCCC1c1cc(-c2cccc(C#N)c2)on1.
What is the InChIKey of methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The InChIKey is APTSBMJQUQPBHQ-ZPHPHTNESA-N. The full InChI is InChI=1S/C17H18N4OS/c1-19-17(23-2)21-8-4-7-15(21)14-10-16(22-20-14)13-6-3-5-12(9-13)11-18/h3,5-6,9-10,15H,4,7-8H2,1-2H3/b19-17-.
What are the key properties of methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate has a molecular weight of 326.43 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(3-cyanophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate is sourced from PubChem (CID 24775720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).