C27H21F10NO2 — CID 24775748
1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol (PubChem CID 24775748) has the molecular formula C27H21F10NO2 and a molecular weight of 581.45 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 24775748 |
| Molecular Formula | C27H21F10NO2 |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
| SMILES | OC(CN1c2cccc(-c3cccc(C(F)(F)F)c3)c2CCC1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C27H21F10NO2/c28-24(29)27(36,37)40-18-7-2-5-16(13-18)21-11-10-20-19(15-4-1-6-17(12-15)25(30,31)32)8-3-9-22(20)38(21)14-23(39)26(33,34)35/h1-9,12-13,21,23-24,39H,10-11,14H2 |
| InChIKey | VRKMFDULORCAST-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|