About 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one
7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one (PubChem CID 24776207) has the molecular formula C22H14ClFN2OS
and a molecular weight of 408.89 g/mol. Its IUPAC name is 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one.
Molecular Properties
| Compound Name | 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one |
| PubChem CID | 24776207 |
| Molecular Formula | C22H14ClFN2OS |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one |
| SMILES | O=C1Nc2ccccc2C12C=C(c1ccc(F)cc1)Nc1cc(Cl)ccc1S2 |
| InChI | InChI=1S/C22H14ClFN2OS/c23-14-7-10-20-18(11-14)25-19(13-5-8-15(24)9-6-13)12-22(28-20)16-3-1-2-4-17(16)26-21(22)27/h1-12,25H,(H,26,27) |
| InChIKey | RPGXVYFOABIXFE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one?
The IUPAC name of 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one (CID 24776207) is 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one.
What is the SMILES notation for 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one?
The canonical SMILES for 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one is O=C1Nc2ccccc2C12C=C(c1ccc(F)cc1)Nc1cc(Cl)ccc1S2.
What is the InChIKey of 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one?
The InChIKey is RPGXVYFOABIXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14ClFN2OS/c23-14-7-10-20-18(11-14)25-19(13-5-8-15(24)9-6-13)12-22(28-20)16-3-1-2-4-17(16)26-21(22)27/h1-12,25H,(H,26,27).
What are the key properties of 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one?
7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one has a molecular weight of 408.89 g/mol, XLogP of 5.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-chloro-4'-(4-fluorophenyl)spiro[1H-indole-3,2'-5H-1,5-benzothiazepine]-2-one is sourced from PubChem (CID 24776207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).