C22H19FN2O5 — CID 24776289
4-(1'-benzyl-5-fluoro-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl)butanoic acid (PubChem CID 24776289) has the molecular formula C22H19FN2O5 and a molecular weight of 410.40 g/mol. Its IUPAC name is 4-(1'-benzyl-5-fluoro-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl)butanoic acid.
| Compound Name | 4-(1'-benzyl-5-fluoro-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl)butanoic acid |
|---|---|
| PubChem CID | 24776289 |
| Molecular Formula | C22H19FN2O5 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-(1'-benzyl-5-fluoro-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl)butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2(CC(=O)N(Cc3ccccc3)C2=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H19FN2O5/c23-15-8-9-17-16(11-15)22(20(29)24(17)10-4-7-19(27)28)12-18(26)25(21(22)30)13-14-5-2-1-3-6-14/h1-3,5-6,8-9,11H,4,7,10,12-13H2,(H,27,28) |
| InChIKey | PYIYAEQVFIVXDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|