C23H17ClN4O7 — CID 24776293
2-[5-chloro-1'-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid (PubChem CID 24776293) has the molecular formula C23H17ClN4O7 and a molecular weight of 496.86 g/mol. Its IUPAC name is 2-[5-chloro-1'-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-1'-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776293 |
| Molecular Formula | C23H17ClN4O7 |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-[5-chloro-1'-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
| SMILES | COc1ccc(-c2nc(CN3C(=O)CC4(C3=O)C(=O)N(CC(=O)O)c3ccc(Cl)cc34)no2)cc1 |
| InChI | InChI=1S/C23H17ClN4O7/c1-34-14-5-2-12(3-6-14)20-25-17(26-35-20)10-28-18(29)9-23(22(28)33)15-8-13(24)4-7-16(15)27(21(23)32)11-19(30)31/h2-8H,9-11H2,1H3,(H,30,31) |
| InChIKey | FNJGDJONLJMSIZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|