About 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole
2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole (PubChem CID 24776350) has the molecular formula C23H24N4O2
and a molecular weight of 388.50 g/mol. Its IUPAC name is [3-(2-ethylbenzimidazol-1-yl)pyrrolidin-1-yl]-(5-methoxy-1H-indol-2-yl)methanone.
Molecular Properties
| Compound Name | 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole |
| PubChem CID | 24776350 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [3-(2-ethylbenzimidazol-1-yl)pyrrolidin-1-yl]-(5-methoxy-1H-indol-2-yl)methanone |
| SMILES | CCC1=NC2=CC=CC=C2N1C3CCN(C3)C(=O)C4=CC5=C(N4)C=CC(=C5)OC |
| InChI | InChI=1S/C23H24N4O2/c1-3-22-25-19-6-4-5-7-21(19)27(22)16-10-11-26(14-16)23(28)20-13-15-12-17(29-2)8-9-18(15)24-20/h4-9,12-13,16,24H,3,10-11,14H2,1-2H3 |
| InChIKey | QVEGWYOUJZKXIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 601 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole?
The IUPAC name of 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole (CID 24776350) is [3-(2-ethylbenzimidazol-1-yl)pyrrolidin-1-yl]-(5-methoxy-1H-indol-2-yl)methanone.
What is the SMILES notation for 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole?
The canonical SMILES for 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole is CCC1=NC2=CC=CC=C2N1C3CCN(C3)C(=O)C4=CC5=C(N4)C=CC(=C5)OC.
What is the InChIKey of 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole?
The InChIKey is QVEGWYOUJZKXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-3-22-25-19-6-4-5-7-21(19)27(22)16-10-11-26(14-16)23(28)20-13-15-12-17(29-2)8-9-18(15)24-20/h4-9,12-13,16,24H,3,10-11,14H2,1-2H3.
What are the key properties of 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole?
2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole has a molecular weight of 388.50 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-{1-[(5-methoxy-1H-indol-2-yl)carbonyl]pyrrolidin-3-yl}-1H-1,3-benzodiazole is sourced from PubChem (CID 24776350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).