C22H23NO5 — CID 24776382
2-[(1S)-5-[3-[(3-methyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 24776382) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[(3-methyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[(3-methyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776382 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[(1S)-5-[3-[(3-methyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | Cc1noc2cc(OCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)ccc12 |
| InChI | InChI=1S/C22H23NO5/c1-14-19-7-5-18(13-21(19)28-23-14)27-10-2-9-26-17-6-8-20-15(11-17)3-4-16(20)12-22(24)25/h5-8,11,13,16H,2-4,9-10,12H2,1H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | OSVNFBIFFWEZCZ-INIZCTEOSA-N |
| XLogP | 4.49 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|