C21H21NO5 — CID 24776385
2-[(1S)-5-[3-(1,3-benzoxazol-6-yloxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 24776385) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[(1S)-5-[3-(1,3-benzoxazol-6-yloxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-(1,3-benzoxazol-6-yloxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776385 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[(1S)-5-[3-(1,3-benzoxazol-6-yloxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CCc2cc(OCCCOc3ccc4ncoc4c3)ccc21 |
| InChI | InChI=1S/C21H21NO5/c23-21(24)11-15-3-2-14-10-16(4-6-18(14)15)25-8-1-9-26-17-5-7-19-20(12-17)27-13-22-19/h4-7,10,12-13,15H,1-3,8-9,11H2,(H,23,24)/t15-/m0/s1 |
| InChIKey | OSMZPSCTDMDVAT-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|