C13H18O2 — CID 24776843
(1S,4R,6R,9S)-4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one (PubChem CID 24776843) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1S,4R,6R,9S)-4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one.
| Compound Name | (1S,4R,6R,9S)-4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one |
|---|---|
| PubChem CID | 24776843 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1S,4R,6R,9S)-4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one |
| SMILES | C=C1C[C@@]23CC[C@@H](O)C[C@H]2C(=O)C[C@@H]1C3 |
| InChI | InChI=1S/C13H18O2/c1-8-6-13-3-2-10(14)5-11(13)12(15)4-9(8)7-13/h9-11,14H,1-7H2/t9-,10-,11+,13-/m1/s1 |
| InChIKey | AAZLDTYDNKRFEP-HNCHTBHHSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|