C13H16N2O3 — CID 24776952
1-(4,5-dihydroxypentyl)quinoxalin-2-one (PubChem CID 24776952) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(4,5-dihydroxypentyl)quinoxalin-2-one.
| Compound Name | 1-(4,5-dihydroxypentyl)quinoxalin-2-one |
|---|---|
| PubChem CID | 24776952 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(4,5-dihydroxypentyl)quinoxalin-2-one |
| SMILES | O=c1cnc2ccccc2n1CCCC(O)CO |
| InChI | InChI=1S/C13H16N2O3/c16-9-10(17)4-3-7-15-12-6-2-1-5-11(12)14-8-13(15)18/h1-2,5-6,8,10,16-17H,3-4,7,9H2 |
| InChIKey | KCABAIQYIZTXOB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |