C17H15NO — CID 24777189
2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-ol (PubChem CID 24777189) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-ol.
| Compound Name | 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-ol |
|---|---|
| PubChem CID | 24777189 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-ol |
| SMILES | OC1CCCc2nc(C#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H15NO/c19-17-8-4-7-16-15(17)12-11-14(18-16)10-9-13-5-2-1-3-6-13/h1-3,5-6,11-12,17,19H,4,7-8H2 |
| InChIKey | VUDNTKZUIAXLLZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|