C26H38N4O8 — CID 24777262
prop-2-enyl 3-[3-methyl-1-[6-[3-methyl-2,5-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)imidazolidin-1-yl]hexyl]-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 24777262) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is prop-2-enyl 3-[3-methyl-1-[6-[3-methyl-2,5-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)imidazolidin-1-yl]hexyl]-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | prop-2-enyl 3-[3-methyl-1-[6-[3-methyl-2,5-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)imidazolidin-1-yl]hexyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 24777262 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | prop-2-enyl 3-[3-methyl-1-[6-[3-methyl-2,5-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)imidazolidin-1-yl]hexyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | C=CCOC(=O)CCC1C(=O)N(CCCCCCN2C(=O)C(CCC(=O)OCC=C)N(C)C2=O)C(=O)N1C |
| InChI | InChI=1S/C26H38N4O8/c1-5-17-37-21(31)13-11-19-23(33)29(25(35)27(19)3)15-9-7-8-10-16-30-24(34)20(28(4)26(30)36)12-14-22(32)38-18-6-2/h5-6,19-20H,1-2,7-18H2,3-4H3 |
| InChIKey | QIUUDLJWTUPCML-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|