C23H27F6N5O3 — CID 24777437
tert-butyl N-[(2R)-4-[(5R,8S)-5,8-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 24777437) has the molecular formula C23H27F6N5O3 and a molecular weight of 535.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[(5R,8S)-5,8-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[(5R,8S)-5,8-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 24777437 |
| Molecular Formula | C23H27F6N5O3 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | tert-butyl N-[(2R)-4-[(5R,8S)-5,8-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | C[C@@H]1CN(C(=O)C[C@@H](Cc2cc(F)c(F)cc2F)NC(=O)OC(C)(C)C)[C@@H](C)c2nnc(C(F)(F)F)n21 |
| InChI | InChI=1S/C23H27F6N5O3/c1-11-10-33(12(2)19-31-32-20(34(11)19)23(27,28)29)18(35)8-14(30-21(36)37-22(3,4)5)6-13-7-16(25)17(26)9-15(13)24/h7,9,11-12,14H,6,8,10H2,1-5H3,(H,30,36)/t11-,12+,14-/m1/s1 |
| InChIKey | NLLXUHUNEXFMRD-MBNYWOFBSA-N |
| XLogP | 4.70 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|