C13H18N4S — CID 24777501
N-butyl-2-ethylsulfanylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 24777501) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-butyl-2-ethylsulfanylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-2-ethylsulfanylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 24777501 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-butyl-2-ethylsulfanylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(SCC)nc2ncccc12 |
| InChI | InChI=1S/C13H18N4S/c1-3-5-8-14-11-10-7-6-9-15-12(10)17-13(16-11)18-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,14,15,16,17) |
| InChIKey | LFSKBZRFJPYQGK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|