About 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride
7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride (PubChem CID 24777579) has the molecular formula C18H20ClNO2
and a molecular weight of 317.82 g/mol. Its IUPAC name is 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride |
| PubChem CID | 24777579 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride |
| SMILES | CC1(C)CC(=O)c2ccc(OCc3ccccc3)nc2C1.Cl |
| InChI | InChI=1S/C18H19NO2.ClH/c1-18(2)10-15-14(16(20)11-18)8-9-17(19-15)21-12-13-6-4-3-5-7-13;/h3-9H,10-12H2,1-2H3;1H |
| InChIKey | OQCQYYLMRLVMLB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride?
The IUPAC name of 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride (CID 24777579) is 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride.
What is the SMILES notation for 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride?
The canonical SMILES for 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride is CC1(C)CC(=O)c2ccc(OCc3ccccc3)nc2C1.Cl.
What is the InChIKey of 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride?
The InChIKey is OQCQYYLMRLVMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2.ClH/c1-18(2)10-15-14(16(20)11-18)8-9-17(19-15)21-12-13-6-4-3-5-7-13;/h3-9H,10-12H2,1-2H3;1H.
What are the key properties of 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride?
7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride has a molecular weight of 317.82 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-2-phenylmethoxy-6,8-dihydroquinolin-5-one;hydrochloride is sourced from PubChem (CID 24777579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).