C30H25ClN2O3S — CID 24777726
(NE)-N-[1-[(2S,3R)-2-benzoyl-3-(2-chlorophenyl)aziridin-1-yl]-2-phenylethylidene]-4-methylbenzenesulfonamide (PubChem CID 24777726) has the molecular formula C30H25ClN2O3S and a molecular weight of 529.06 g/mol. Its IUPAC name is (NE)-N-[1-[(2S,3R)-2-benzoyl-3-(2-chlorophenyl)aziridin-1-yl]-2-phenylethylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[1-[(2S,3R)-2-benzoyl-3-(2-chlorophenyl)aziridin-1-yl]-2-phenylethylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24777726 |
| Molecular Formula | C30H25ClN2O3S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (NE)-N-[1-[(2S,3R)-2-benzoyl-3-(2-chlorophenyl)aziridin-1-yl]-2-phenylethylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\Cc2ccccc2)N2[C@H](C(=O)c3ccccc3)[C@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H25ClN2O3S/c1-21-16-18-24(19-17-21)37(35,36)32-27(20-22-10-4-2-5-11-22)33-28(25-14-8-9-15-26(25)31)29(33)30(34)23-12-6-3-7-13-23/h2-19,28-29H,20H2,1H3/b32-27+/t28-,29+,33?/m1/s1 |
| InChIKey | DPGNLOSRKGMGSQ-WDIWOWINSA-N |
| XLogP | 6.29 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|