C18H20ClF6N5O — CID 24777807
(3R)-3-amino-1-[8,8-dimethyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 24777807) has the molecular formula C18H20ClF6N5O and a molecular weight of 471.83 g/mol. Its IUPAC name is (3R)-3-amino-1-[8,8-dimethyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[8,8-dimethyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 24777807 |
| Molecular Formula | C18H20ClF6N5O |
| Molecular Weight | 471.83 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (3R)-3-amino-1-[8,8-dimethyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | CC1(C)c2nnc(C(F)(F)F)n2CCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C18H19F6N5O.ClH/c1-17(2)15-26-27-16(18(22,23)24)28(15)3-4-29(17)14(30)7-10(25)5-9-6-12(20)13(21)8-11(9)19;/h6,8,10H,3-5,7,25H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | RXKJSZVEJJOWGQ-HNCPQSOCSA-N |
| XLogP | 3.17 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|