About 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide
1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide (PubChem CID 2477783) has the molecular formula C19H14N4OS
and a molecular weight of 346.42 g/mol. Its IUPAC name is 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide |
| PubChem CID | 2477783 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H14N4OS/c24-18(21-19-20-11-12-25-19)17-13-16(14-7-3-1-4-8-14)22-23(17)15-9-5-2-6-10-15/h1-13H,(H,20,21,24) |
| InChIKey | WRDNTZCOFSIWOL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The IUPAC name of 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide (CID 2477783) is 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide.
What is the SMILES notation for 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The canonical SMILES for 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide is O=C(Nc1nccs1)c1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The InChIKey is WRDNTZCOFSIWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4OS/c24-18(21-19-20-11-12-25-19)17-13-16(14-7-3-1-4-8-14)22-23(17)15-9-5-2-6-10-15/h1-13H,(H,20,21,24).
What are the key properties of 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide has a molecular weight of 346.42 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenyl-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide is sourced from PubChem (CID 2477783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).