C17H15N — CID 24777940
2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinoline (PubChem CID 24777940) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 24777940 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinoline |
| SMILES | C(#Cc1ccc2c(n1)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C17H15N/c1-2-6-14(7-3-1)10-12-16-13-11-15-8-4-5-9-17(15)18-16/h1-3,6-7,11,13H,4-5,8-9H2 |
| InChIKey | WGJNWKPVRLKAIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|