C8H12O3 — CID 24777980
[(4S,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 24777980) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is [(4S,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 24777980 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | [(4S,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C#C[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C8H12O3/c1-4-6-7(5-9)11-8(2,3)10-6/h1,6-7,9H,5H2,2-3H3/t6-,7-/m0/s1 |
| InChIKey | WVBSRHKZWGFGDO-BQBZGAKWSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|