C11H14O4 — CID 24778112
(1S,2R,3R,4R)-3-methyl-2,4-dihydro-1H-naphthalene-1,2,3,4-tetrol (PubChem CID 24778112) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-methyl-2,4-dihydro-1H-naphthalene-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R,4R)-3-methyl-2,4-dihydro-1H-naphthalene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 24778112 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1S,2R,3R,4R)-3-methyl-2,4-dihydro-1H-naphthalene-1,2,3,4-tetrol |
| SMILES | C[C@@]1(O)[C@H](O)c2ccccc2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14O4/c1-11(15)9(13)7-5-3-2-4-6(7)8(12)10(11)14/h2-5,8-10,12-15H,1H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | HMKXIOZQNMGYSJ-LNFKQOIKSA-N |
| XLogP | -0.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |