About 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene
3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene (PubChem CID 24778233) has the molecular formula C7H9F6O3P
and a molecular weight of 286.11 g/mol. Its IUPAC name is 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene.
Molecular Properties
| Compound Name | 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene |
| PubChem CID | 24778233 |
| Molecular Formula | C7H9F6O3P |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene |
| SMILES | C=CCP(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C7H9F6O3P/c1-2-3-17(14,15-4-6(8,9)10)16-5-7(11,12)13/h2H,1,3-5H2 |
| InChIKey | AUHQPXBEJQHIIJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene?
The IUPAC name of 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene (CID 24778233) is 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene.
What is the SMILES notation for 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene?
The canonical SMILES for 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene is C=CCP(=O)(OCC(F)(F)F)OCC(F)(F)F.
What is the InChIKey of 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene?
The InChIKey is AUHQPXBEJQHIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F6O3P/c1-2-3-17(14,15-4-6(8,9)10)16-5-7(11,12)13/h2H,1,3-5H2.
What are the key properties of 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene?
3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene has a molecular weight of 286.11 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(2,2,2-trifluoroethoxy)phosphoryl]prop-1-ene is sourced from PubChem (CID 24778233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).