C9H17NO5 — CID 24778343
(1R,2S,6S,7S,8R,8aR)-6-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizine-1,2,6,7,8-pentol (PubChem CID 24778343) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is (1R,2S,6S,7S,8R,8aR)-6-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizine-1,2,6,7,8-pentol.
| Compound Name | (1R,2S,6S,7S,8R,8aR)-6-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizine-1,2,6,7,8-pentol |
|---|---|
| PubChem CID | 24778343 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (1R,2S,6S,7S,8R,8aR)-6-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizine-1,2,6,7,8-pentol |
| SMILES | C[C@]1(O)CN2C[C@H](O)[C@H](O)[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO5/c1-9(15)3-10-2-4(11)6(12)5(10)7(13)8(9)14/h4-8,11-15H,2-3H2,1H3/t4-,5+,6-,7+,8-,9-/m0/s1 |
| InChIKey | XWLSKUDERJALSC-WEHQQBAWSA-N |
| XLogP | -3.12 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |