About N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide
N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide (PubChem CID 2477849) has the molecular formula C21H23N3OS
and a molecular weight of 365.50 g/mol. Its IUPAC name is N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
| PubChem CID | 2477849 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
| SMILES | CC(C)(C)NC(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H23N3OS/c1-21(2,3)24-17(25)14-26-20-22-18(15-10-6-4-7-11-15)19(23-20)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | DAKDWEDFCMMLIC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide?
The IUPAC name of N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide (CID 2477849) is N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide.
What is the SMILES notation for N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide?
The canonical SMILES for N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide is CC(C)(C)NC(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide?
The InChIKey is DAKDWEDFCMMLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3OS/c1-21(2,3)24-17(25)14-26-20-22-18(15-10-6-4-7-11-15)19(23-20)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H,22,23)(H,24,25).
What are the key properties of N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide?
N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide has a molecular weight of 365.50 g/mol, XLogP of 4.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide is sourced from PubChem (CID 2477849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).